
CAS 108567-70-0
:(3R)-4-[(2R,4S)-4-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-2-hydroxy-2,6,6-trimethylcyclohexylidene]-3-buten-2-one
Description:
The chemical substance with the name "(3R)-4-[(2R,4S)-4-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-2-hydroxy-2,6,6-trimethylcyclohexylidene]-3-buten-2-one" and CAS number "108567-70-0" is a complex organic compound characterized by its intricate structure, which includes multiple stereocenters and functional groups. It features a butenone moiety, indicating the presence of a conjugated double bond system, which can contribute to its reactivity and potential biological activity. The compound also contains sugar moieties, specifically a furanosyl and glucopyranosyl unit, suggesting that it may exhibit properties typical of glycosides, such as solubility in water and potential interactions with biological systems. The presence of hydroxyl groups enhances its polarity and may influence its solubility and reactivity. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and natural product research. Further studies would be necessary to elucidate its biological activity and potential applications.
Formula:C24H38O12
InChI:InChI=1S/C24H38O12/c1-12(26)5-6-15-22(2,3)7-13(8-23(15,4)31)35-20-18(29)17(28)16(27)14(36-20)9-33-21-19(30)24(32,10-25)11-34-21/h5,13-14,16-21,25,27-32H,7-11H2,1-4H3
InChI key:InChIKey=WGFLJEFKPRMWSU-UHFFFAOYSA-N
SMILES:C(=CC(C)=O)=C1C(C)(C)CC(OC2OC(COC3C(O)C(CO)(O)CO3)C(O)C(O)C2O)CC1(C)O
Synonyms:- 3-Buten-2-one, 4-[(2R,4S)-4-[(6-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-2-hydroxy-2,6,6-trimethylcyclohexylidene]-, (3R)-
- Cinnamoside
- (3R)-4-[(2R,4S)-4-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-2-hydroxy-2,6,6-trimethylcyclohexylidene]-3-buten-2-one
- 3-Buten-2-one, 4-[4-[(6-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-2-hydroxy-2,6,6-trimethylcyclohexylidene]-, [2R-(1R*,2α,4β)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cinnamoside
CAS:Cinnamoside is a useful organic compound for research related to life sciences. The catalog number is T126431 and the CAS number is 108567-70-0.Formula:C24H38O12Color and Shape:SolidMolecular weight:518.556
