
CAS 108605-64-7
:2,2′,3,3′,5,5′,6,6′,8,8′,9,9′,11,11′,12,12′-Hexadecahydro-15,15′-bi-1,4,7,10,13-benzopentaoxacyclopentadecin
Description:
The chemical substance known as "2,2′,3,3′,5,5′,6,6′,8,8′,9,9′,11,11′,12,12′-Hexadecahydro-15,15′-bi-1,4,7,10,13-benzopentaoxacyclopentadecin," with the CAS number 108605-64-7, is a complex organic compound characterized by its unique polycyclic structure and multiple ether linkages. This compound features a fused ring system that incorporates both aromatic and aliphatic characteristics, contributing to its stability and potential reactivity. The presence of multiple oxygen atoms in the form of ether groups suggests that it may exhibit interesting solubility properties and could participate in various chemical reactions, such as oxidation or reduction. Its intricate structure may also imply potential applications in materials science or medicinal chemistry, although specific applications would depend on further research into its biological activity and physical properties. Overall, this compound represents a fascinating example of synthetic organic chemistry, showcasing the diversity of molecular architectures that can be achieved through careful design and synthesis.
Formula:C28H38O10
InChI:InChI=1S/C28H38O10/c1-3-25-27(37-19-15-33-11-7-29-5-9-31-13-17-35-25)21-23(1)24-2-4-26-28(22-24)38-20-16-34-12-8-30-6-10-32-14-18-36-26/h1-4,21-22H,5-20H2
InChI key:InChIKey=RCKXGJUJZHASAW-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)OCCOCCOCCOCCO2)C=3C=C4C(=CC3)OCCOCCOCCOCCO4
Synonyms:- 1,4,7,10,13-Benzopentaoxacyclopentadecin, bimol. deriv.
- Bis(benzo-15-crown-5)
- 15,15′-Bi-1,4,7,10,13-benzopentaoxacyclopentadecin, 2,2′,3,3′,5,5′,6,6′,8,8′,9,9′,11,11′,12,12′-hexadecahydro-
- 2,2′,3,3′,5,5′,6,6′,8,8′,9,9′,11,11′,12,12′-Hexadecahydro-15,15′-bi-1,4,7,10,13-benzopentaoxacyclopentadecin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
