CAS 1086062-66-9: Omipalisib
Description:Omipalisib, also known by its chemical name GSK2126458, is a small molecule inhibitor primarily targeting the phosphoinositide 3-kinase (PI3K) pathway, which plays a crucial role in various cellular processes, including growth, proliferation, and survival. It is particularly noted for its potential therapeutic applications in oncology, especially in cancers with aberrant PI3K signaling. Omipalisib exhibits a high degree of selectivity for specific PI3K isoforms, which contributes to its efficacy and safety profile. The compound is typically administered orally and has been evaluated in clinical trials for its effectiveness in treating solid tumors and hematological malignancies. Its mechanism of action involves the inhibition of downstream signaling pathways that are activated by PI3K, thereby inducing apoptosis in cancer cells. Additionally, Omipalisib's pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are critical for determining its dosing regimen and potential drug interactions. Overall, Omipalisib represents a significant advancement in targeted cancer therapy, focusing on the modulation of key signaling pathways involved in tumorigenesis.
Formula:C25H17F2N5O3S
InChI:InChI=1S/C25H17F2N5O3S/c1-35-25-23(32-36(33,34)24-5-3-18(26)12-21(24)27)11-17(13-29-25)15-2-4-22-20(10-15)19(7-8-28-22)16-6-9-30-31-14-16/h2-14,32H,1H3
InChI key:InChIKey=CGBJSGAELGCMKE-UHFFFAOYSA-N
SMILES:O=S(=O)(NC=1C=C(C=NC1OC)C=2C=CC3=NC=CC(C=4C=NN=CC4)=C3C2)C5=CC=C(F)C=C5F
- Synonyms:
- 2,4-Difluoro-N-[2-methoxy-5-[4-(4-pyridazinyl)-6-quinolinyl]-3-pyridinyl]benzenesulfonamide
- Benzenesulfonamide, 2,4-difluoro-N-[2-methoxy-5-[4-(4-pyridazinyl)-6-quinolinyl]-3-pyridinyl]-
- Gsk 2126458
- Gsk 458
- Gsk2126458
- Omipalisib
