CymitQuimica logo

CAS 1086064-93-8

:

5-Bromo-N-(phenylmethyl)-3-pyridinesulfonamide

Description:
5-Bromo-N-(phenylmethyl)-3-pyridinesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 5-position of the pyridine ring enhances its reactivity and potential biological activity. The phenylmethyl group attached to the nitrogen atom contributes to the compound's lipophilicity, which may influence its pharmacokinetic properties. This compound is typically used in medicinal chemistry and may exhibit various biological activities, including antimicrobial effects. Its structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the sulfonamide moiety is often associated with a range of therapeutic applications, particularly in the treatment of bacterial infections. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 5-Bromo-N-(phenylmethyl)-3-pyridinesulfonamide represents a class of compounds with significant interest in pharmaceutical research.
Formula:C12H11BrN2O2S
InChI:InChI=1S/C12H11BrN2O2S/c13-11-6-12(9-14-8-11)18(16,17)15-7-10-4-2-1-3-5-10/h1-6,8-9,15H,7H2
InChI key:InChIKey=FJHYXLHXSYJIHN-UHFFFAOYSA-N
SMILES:S(NCC1=CC=CC=C1)(=O)(=O)C=2C=C(Br)C=NC2
Synonyms:
  • 5-Bromo-N-(phenylmethyl)-3-pyridinesulfonamide
  • 3-Pyridinesulfonamide, 5-bromo-N-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.