CymitQuimica logo

CAS 108607-02-9

:

H-Glu(OtBu)-NH2 . HCl

Description:
The chemical substance "H-Glu(OtBu)-NH2·HCl," with the CAS number 108607-02-9, is a hydrochloride salt of a modified amino acid derivative of glutamic acid. This compound features a tert-butyl ester (OtBu) group attached to the side chain of the glutamic acid, which enhances its lipophilicity and stability. The presence of the amino group (NH2) indicates that it can participate in various chemical reactions, including peptide bond formation. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for biological applications. The compound may exhibit properties such as being a potential building block in peptide synthesis or serving as a ligand in coordination chemistry. Its structure allows for various interactions, making it useful in pharmaceutical and biochemical research. Overall, H-Glu(OtBu)-NH2·HCl is characterized by its modified amino acid structure, solubility, and potential applications in synthetic chemistry and drug development.
Formula:CH18N2O3·HCl
InChI:InChI=1S/C9H18N2O3.ClH/c1-9(2,3)14-7(12)5-4-6(10)8(11)13;/h6H,4-5,10H2,1-3H3,(H2,11,13);1H/t6-;/m0./s1
InChI key:NWLREMKEFHDCSV-RGMNGODLSA-N
SMILES:CC(C)(C)OC(=O)CC[C@@H](C(=O)N)N.Cl
Synonyms:
  • H-Glu(OtBu)-NH2・HCl
  • H-Glu(OtBu)-NH2.HCl
  • H-Glu(Otbu)-Nh2 Hcl
Found 7 products.