CymitQuimica logo

CAS 108612-60-8

:

2-[{1-[1-(4-fluorobenzyl)-1H-benzimidazol-2-yl]piperidin-4-yl}(methyl)amino]-6-methylpyrimidin-4(1H)-one

Description:
The chemical substance known as 2-[{1-[1-(4-fluorobenzyl)-1H-benzimidazol-2-yl]piperidin-4-yl}(methyl)amino]-6-methylpyrimidin-4(1H)-one, with the CAS number 108612-60-8, is a complex organic compound characterized by its multi-ring structure, which includes a benzimidazole and a pyrimidinone moiety. This compound features a piperidine ring, which contributes to its potential biological activity. The presence of a fluorobenzyl group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The methyl and amino substituents enhance its solubility and reactivity. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The specific arrangement of functional groups and the overall molecular architecture can significantly affect the compound's efficacy, selectivity, and safety profile in biological systems. As with many synthetic organic compounds, understanding its characteristics requires consideration of its physical properties, reactivity, and potential interactions with biological macromolecules.
Formula:C25H27FN6O
InChI:InChI=1/C25H27FN6O/c1-17-15-23(33)29-24(27-17)30(2)20-11-13-31(14-12-20)25-28-21-5-3-4-6-22(21)32(25)16-18-7-9-19(26)10-8-18/h3-10,15,20H,11-14,16H2,1-2H3,(H,27,29,33)
SMILES:Cc1cc(nc(n1)N(C)C1CCN(CC1)c1nc2ccccc2n1Cc1ccc(cc1)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.