CAS 108630-69-9

Ethyl 5,5-dimethoxy-2,4-dioxopentanoate

Description:

Ethyl 5,5-dimethoxy-2,4-dioxopentanoate, with the CAS number 108630-69-9, is an organic compound characterized by its ester functional group and a complex molecular structure. It features a pentanoate backbone with two methoxy groups attached to the fifth carbon, contributing to its unique reactivity and solubility properties. The presence of two carbonyl groups (dioxo) indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, making it useful in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Ethyl 5,5-dimethoxy-2,4-dioxopentanoate may also exhibit biological activity, although specific applications or effects would depend on further research. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.

Formula: C₉H₁₄O₆

InChI: InChI=1S/C9H14O6/c1-4-15-8(12)6(10)5-7(11)9(13-2)14-3/h9H,4-5H2,1-3H3

InChI key: InChIKey=HSOIHCXMVSKELR-UHFFFAOYSA-N

SMILES: C(C(OC)OC)(CC(C(OCC)=O)=O)=O

Synonyms:

• Ethyl 5,5-dimethoxy-2,4-dioxopentanoate
• Glutaraldehydic acid, 2,4-dioxo-, ethyl ester, dimethyl acetal
• Pentanoic acid, 5,5-dimethoxy-2,4-dioxo-, ethyl ester