CAS 1086375-17-8

1-[(3-Chlorophenyl)methyl]-3-pyrrolidinecarboxylic acid

Description:

1-[(3-Chlorophenyl)methyl]-3-pyrrolidinecarboxylic acid, identified by its CAS number 1086375-17-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a chlorophenyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a potential candidate for various applications in medicinal chemistry and drug development. The presence of the chlorophenyl moiety may influence its biological activity and lipophilicity, potentially enhancing its interaction with biological targets. Additionally, the carboxylic acid functional group can participate in hydrogen bonding and ionic interactions, which are crucial for solubility and reactivity. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the substituents on the pyrrolidine and phenyl rings. Overall, this compound's structural features suggest it could be of interest in the development of pharmaceuticals or agrochemicals.

Formula: C₁₂H₁₄ClNO₂

InChI: InChI=1S/C12H14ClNO2/c13-11-3-1-2-9(6-11)7-14-5-4-10(8-14)12(15)16/h1-3,6,10H,4-5,7-8H2,(H,15,16)

InChI key: InChIKey=CSUXSPUXCRBQIF-UHFFFAOYSA-N

SMILES: C(N1CC(C(O)=O)CC1)C2=CC(Cl)=CC=C2

Synonyms:

• 1-[(3-Chlorophenyl)methyl]-3-pyrrolidinecarboxylic acid
• 3-Pyrrolidinecarboxylic acid, 1-[(3-chlorophenyl)methyl]-