CAS 1086375-34-9
:1-[(4-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid
Description:
1-[(4-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid, identified by its CAS number 1086375-34-9, is a chemical compound characterized by its unique structural features. It consists of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, substituted with a carboxylic acid group and a 4-methoxybenzyl moiety. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of both carboxylic acids and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions, given the pyrrolidine framework's prevalence in various bioactive compounds. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c1-17-12-4-2-10(3-5-12)8-14-7-6-11(9-14)13(15)16/h2-5,11H,6-9H2,1H3,(H,15,16)
InChI key:InChIKey=WSTCPBQWRCQFKL-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1)C2=CC=C(OC)C=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-[(4-methoxyphenyl)methyl]-
- 1-(4-Methoxybenzyl)pyrrolidine-3-carboxylic acid
- 1-[(4-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.