CymitQuimica logo

CAS 1086375-38-3

:

1-[(3-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid

Description:
1-[(3-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid, identified by its CAS number 1086375-38-3, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a methoxyphenyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its structural motifs, making it a subject of interest in medicinal chemistry. Its molecular interactions could be significant in various biological systems, possibly affecting neurotransmitter pathways or other physiological processes. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c1-17-12-4-2-3-10(7-12)8-14-6-5-11(9-14)13(15)16/h2-4,7,11H,5-6,8-9H2,1H3,(H,15,16)
InChI key:InChIKey=ODQCNCXOWDUYGL-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1)C2=CC(OC)=CC=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[(3-methoxyphenyl)methyl]-
  • 1-[(3-Methoxyphenyl)methyl]-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.