
CAS 1086375-40-7
:1-[[3-(Trifluoromethyl)phenyl]methyl]-3-pyrrolidinecarboxylic acid
Description:
1-[[3-(Trifluoromethyl)phenyl]methyl]-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a trifluoromethyl-substituted phenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The pyrrolidine moiety is a five-membered nitrogen-containing ring that can participate in hydrogen bonding and may affect the compound's conformational flexibility. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific interactions and properties would depend on the context of its use, including solubility, stability, and reactivity under different conditions.
Formula:C13H14F3NO2
InChI:InChI=1S/C13H14F3NO2/c14-13(15,16)11-3-1-2-9(6-11)7-17-5-4-10(8-17)12(18)19/h1-3,6,10H,4-5,7-8H2,(H,18,19)
InChI key:InChIKey=OPOBJQXZUHNPHG-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-[[3-(trifluoromethyl)phenyl]methyl]-
- 1-[[3-(Trifluoromethyl)phenyl]methyl]-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.