CAS 1086375-44-1

3,4-Dihydro-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid

Description:

3,4-Dihydro-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine ring. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of nitrogen atoms in the ring structure can influence its basicity and ability to participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active molecules. Additionally, the presence of multiple functional groups may allow for further derivatization, enhancing its utility in synthetic chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a subject of interest for further research in organic synthesis and drug development.

Formula: C₈H₈N₂O₃

InChI: InChI=1S/C8H8N2O3/c11-8(12)6-4-10-7-5(13-6)2-1-3-9-7/h1-3,6H,4H2,(H,9,10)(H,11,12)

InChI key: InChIKey=UKEQICPGQJOSKO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1OC=2C(NC1)=NC=CC2

Synonyms:

• 3,4-Dihydro-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid
• 2H-Pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid, 3,4-dihydro-

3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid

CAS: 1086375-44-1

3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid

Purity: 95%

Molecular weight: 180.16g/mol

Ref: 54-OR1003481