
CAS 1086375-47-4
:5,6,7,8-Tetrahydro-7,7-dimethyl-5-oxo-3-quinolinecarboxylic acid
Description:
5,6,7,8-Tetrahydro-7,7-dimethyl-5-oxo-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features a tetrahydroquinoline framework, indicating that it has a saturated ring system with additional substituents that contribute to its chemical properties. The presence of a carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The dimethyl groups indicate steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, the keto group (5-oxo) may play a role in its reactivity, potentially participating in condensation reactions or serving as a site for further functionalization. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities or uses would require further investigation.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-12(2)4-9-8(10(14)5-12)3-7(6-13-9)11(15)16/h3,6H,4-5H2,1-2H3,(H,15,16)
InChI key:InChIKey=PYYSGVZPNGPKGD-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC=C(C(O)=O)C2)CC(C)(C)C1
Synonyms:- 3-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-7,7-dimethyl-5-oxo-
- 5,6,7,8-Tetrahydro-7,7-dimethyl-5-oxo-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.