
CAS 1086376-35-3
:5-(5-Bromo-2-furanyl)-2-oxo-1,3,4-oxadiazole-3(2H)-acetic acid
Description:
5-(5-Bromo-2-furanyl)-2-oxo-1,3,4-oxadiazole-3(2H)-acetic acid is a chemical compound characterized by its unique structure, which includes a furanyl group and an oxadiazole moiety. The presence of the bromine atom enhances its reactivity and may influence its biological activity. This compound features a carboxylic acid functional group, which contributes to its acidity and potential solubility in polar solvents. The oxadiazole ring is known for its stability and is often associated with various pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the substituents on the oxadiazole and furanyl rings. Overall, this compound represents a class of heterocyclic compounds that may exhibit diverse chemical and biological activities, warranting further investigation for potential applications in pharmaceuticals or agrochemicals.
Formula:C8H5BrN2O5
InChI:InChI=1S/C8H5BrN2O5/c9-5-2-1-4(15-5)7-10-11(3-6(12)13)8(14)16-7/h1-2H,3H2,(H,12,13)
InChI key:InChIKey=HZFLUPWVUHTEMH-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1N=C(OC1=O)C=2OC(Br)=CC2
Synonyms:- 1,3,4-Oxadiazole-3(2H)-acetic acid, 5-(5-bromo-2-furanyl)-2-oxo-
- 5-(5-Bromo-2-furanyl)-2-oxo-1,3,4-oxadiazole-3(2H)-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.