CAS 1086376-48-8

Pyrimidine, 2-chloro-4-(cyclohexyloxy)-

Description:

Pyrimidine, 2-chloro-4-(cyclohexyloxy)- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 2-position and a cyclohexyloxy group at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine atom and the oxygen in the cyclohexyloxy group, influencing its solubility in various solvents. Pyrimidines are known for their biological significance, often serving as building blocks for nucleic acids and other biomolecules. The specific substitution pattern in this compound may impart distinct reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the cyclohexyloxy group may enhance lipophilicity, affecting the compound's pharmacokinetic properties. Overall, this compound's structure suggests it may have interesting interactions in biological systems, warranting further investigation for potential therapeutic uses.

Formula: C₁₀H₁₃ClN₂O

InChI: InChI=1S/C10H13ClN2O/c11-10-12-7-6-9(13-10)14-8-4-2-1-3-5-8/h6-8H,1-5H2

InChI key: InChIKey=MMBINALOMGPYDR-UHFFFAOYSA-N

SMILES: O(C1=NC(Cl)=NC=C1)C2CCCCC2

Synonyms:

• 2-Chloro-4-cyclohexyloxypyrimidine
• 2-Chloro-4-(cyclohexyloxy)pyrimidine
• Pyrimidine, 2-chloro-4-(cyclohexyloxy)-