
CAS 1086376-64-8
:1-[6-(Trifluoromethyl)-2-pyridinyl]-4-piperidinemethanol
Description:
1-[6-(Trifluoromethyl)-2-pyridinyl]-4-piperidinemethanol, with the CAS number 1086376-64-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a trifluoromethyl group and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, such as moderate polarity and potential solubility in polar organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence biological activity, making it of interest in pharmaceutical research. The hydroxymethyl group contributes to its reactivity, potentially allowing for further derivatization or interaction with biological targets. As a result, this compound may exhibit unique pharmacological properties, which could be explored in various therapeutic contexts. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the trifluoromethyl and hydroxymethyl groups.
Formula:C12H15F3N2O
InChI:InChI=1S/C12H15F3N2O/c13-12(14,15)10-2-1-3-11(16-10)17-6-4-9(8-18)5-7-17/h1-3,9,18H,4-8H2
InChI key:InChIKey=BTRZXGVIMQLXTB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(=CC=C1)N2CCC(CO)CC2
Synonyms:- 1-[6-(Trifluoromethyl)-2-pyridinyl]-4-piperidinemethanol
- 4-Piperidinemethanol, 1-[6-(trifluoromethyl)-2-pyridinyl]-
- [1-[6-(Trifluoromethyl)pyridin-2-yl]piperidin-4-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.