CAS 1086376-68-2

1-Thieno[2,3-d]pyrimidin-4-yl-4-piperidinemethanol

Description:

1-Thieno[2,3-d]pyrimidin-4-yl-4-piperidinemethanol is a chemical compound characterized by its unique structural features, which include a thieno[2,3-d]pyrimidine ring fused with a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the hydroxymethyl group on the piperidine ring suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the thieno[2,3-d]pyrimidine structure is known for its role in medicinal chemistry, often serving as a scaffold for the development of pharmaceuticals. The compound may exhibit moderate to high lipophilicity, affecting its pharmacokinetic properties. Its specific applications and biological activities would depend on further research and characterization, including studies on its mechanism of action, efficacy, and safety profile. Overall, this compound represents a class of molecules with potential therapeutic implications, particularly in the fields of medicinal and organic chemistry.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1S/C12H15N3OS/c16-7-9-1-4-15(5-2-9)11-10-3-6-17-12(10)14-8-13-11/h3,6,8-9,16H,1-2,4-5,7H2

InChI key: InChIKey=BTBMQNURYLJSBS-UHFFFAOYSA-N

SMILES: C(O)C1CCN(C2=C3C(=NC=N2)SC=C3)CC1

Synonyms:

• 4-Piperidinemethanol, 1-thieno[2,3-d]pyrimidin-4-yl-
• 1-Thieno[2,3-d]pyrimidin-4-yl-4-piperidinemethanol
• (1-[Thieno[2,3-d]pyrimidin-4-yl]piperidin-4-yl)methanol
• (1-Thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)methanol

(1-Thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)methanol

CAS: 1086376-68-2

(1-Thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)methanol

Purity: 90%

Molecular weight: 249.34g/mol

Ref: 54-OR1004196