
CAS 1086378-43-9
:3-[[2-(Trifluoromethyl)-4-pyrimidinyl]oxy]benzenamine
Description:
3-[[2-(Trifluoromethyl)-4-pyrimidinyl]oxy]benzenamine, identified by its CAS number 1086378-43-9, is a chemical compound characterized by its complex structure that includes a trifluoromethyl group and a pyrimidine moiety. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The pyrimidine ring contributes to its heterocyclic nature, which can affect its reactivity and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and analysis. Overall, this substance is likely to be of interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C11H8F3N3O
InChI:InChI=1S/C11H8F3N3O/c12-11(13,14)10-16-5-4-9(17-10)18-8-3-1-2-7(15)6-8/h1-6H,15H2
InChI key:InChIKey=NHHKSAJFJGTQCB-UHFFFAOYSA-N
SMILES:O(C1=NC(C(F)(F)F)=NC=C1)C2=CC(N)=CC=C2
Synonyms:- 3-[[2-(Trifluoromethyl)-4-pyrimidinyl]oxy]benzenamine
- Benzenamine, 3-[[2-(trifluoromethyl)-4-pyrimidinyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.