
CAS 1086378-64-4
:5-(2-Pyrazinyl)-1,2,4-oxadiazol-3-amine
Description:
5-(2-Pyrazinyl)-1,2,4-oxadiazol-3-amine is a heterocyclic compound characterized by the presence of both pyrazine and oxadiazole functional groups. This compound features a pyrazinyl group, which contributes to its aromaticity and potential biological activity, and an oxadiazole ring, known for its stability and utility in various chemical applications. The amine functional group enhances its reactivity, making it a candidate for further chemical modifications. Typically, compounds of this nature exhibit properties such as moderate solubility in polar solvents and potential interactions with biological targets, which may lead to applications in pharmaceuticals or agrochemicals. The presence of nitrogen atoms in both the pyrazine and oxadiazole rings can influence the compound's electronic properties, potentially affecting its reactivity and interaction with other molecules. Overall, 5-(2-Pyrazinyl)-1,2,4-oxadiazol-3-amine is of interest for its unique structural features and potential applications in medicinal chemistry and materials science.
Formula:C6H5N5O
InChI:InChI=1S/C6H5N5O/c7-6-10-5(12-11-6)4-3-8-1-2-9-4/h1-3H,(H2,7,11)
InChI key:InChIKey=WSKGJYHBULLFOF-UHFFFAOYSA-N
SMILES:NC=1N=C(ON1)C=2C=NC=CN2
Synonyms:- 1,2,4-Oxadiazol-3-amine, 5-(2-pyrazinyl)-
- 5-(2-Pyrazinyl)-1,2,4-oxadiazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.