
CAS 1086379-16-9
:2-Methyl-4-phenyl-5-oxazolecarboxaldehyde
Description:
2-Methyl-4-phenyl-5-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group and a phenyl group attached to the oxazole ring, contributing to its unique chemical properties. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 2-Methyl-4-phenyl-5-oxazolecarboxaldehyde is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-8-12-11(10(7-13)14-8)9-5-3-2-4-6-9/h2-7H,1H3
InChI key:InChIKey=VPZWWYCPIFWEKE-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N=C(C)O1)C2=CC=CC=C2
Synonyms:- 2-Methyl-4-phenyl-5-oxazolecarboxaldehyde
- 2-Methyl-4-phenyl-1,3-oxazole-5-carbaldehyde
- 5-Oxazolecarboxaldehyde, 2-methyl-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.