
CAS 1086379-30-7
:2-(1-Piperazinyl)-4-pyridinemethanamine
Description:
2-(1-Piperazinyl)-4-pyridinemethanamine, identified by its CAS number 1086379-30-7, is a chemical compound characterized by its piperazine and pyridine functional groups. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The pyridine moiety can enhance the compound's interaction with biological targets, such as receptors or enzymes. Additionally, the structure suggests potential for various chemical modifications, which can lead to derivatives with altered pharmacological properties. Overall, this compound's unique structural features position it as a candidate for further research in drug discovery and development, particularly in areas related to neuropharmacology and other therapeutic applications.
Formula:C10H16N4
InChI:InChI=1S/C10H16N4/c11-8-9-1-2-13-10(7-9)14-5-3-12-4-6-14/h1-2,7,12H,3-6,8,11H2
InChI key:InChIKey=NHSFGBISGFBUJU-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(N=CC1)N2CCNCC2
Synonyms:- 2-(1-Piperazinyl)-4-pyridinemethanamine
- 4-Pyridinemethanamine, 2-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.