CAS 1086379-86-3

2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinecarboxylic acid

Description:

2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinecarboxylic acid, with the CAS number 1086379-86-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry, while the carboxylic acid group can participate in hydrogen bonding and influence solubility in polar solvents. The tetrahydro-2H-pyran unit adds to its structural complexity and may affect its reactivity and interaction with biological systems. Such compounds are often of interest in medicinal chemistry due to their potential biological activities, including antimicrobial or anti-inflammatory properties. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1S/C11H13NO4/c13-11(14)8-1-4-12-10(7-8)16-9-2-5-15-6-3-9/h1,4,7,9H,2-3,5-6H2,(H,13,14)

InChI key: InChIKey=JVKDIDPAEBELMS-UHFFFAOYSA-N

SMILES: O(C1=CC(C(O)=O)=CC=N1)C2CCOCC2

Synonyms:

• 2-(Oxan-4-yloxy)pyridine-4-carboxylic acid
• 2-(Tetrahydro-2H-pyran-4-yloxy)isonicotinic acid
• 4-Pyridinecarboxylic acid, 2-[(tetrahydro-2H-pyran-4-yl)oxy]-
• 2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinecarboxylic acid

2-(Tetrahydro-2H-pyran-4-yloxy)isonicotinic acid

CAS: 1086379-86-3

Purity: 97.0%

Molecular weight: 223.22799682617188

Ref: 10-F065871