CymitQuimica logo

CAS 1086379-88-5

:

2-(4-Piperidinyloxy)-4-pyridinecarboxylic acid

Description:
2-(4-Piperidinyloxy)-4-pyridinecarboxylic acid, identified by its CAS number 1086379-88-5, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a piperidine-derived moiety. This compound is characterized by its potential biological activity, particularly in the context of pharmacology, where it may serve as a lead compound for drug development. The presence of the piperidinyloxy group suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or other cellular pathways. The carboxylic acid functionality contributes to its solubility in polar solvents and may play a role in its reactivity and interaction with biological macromolecules. Additionally, the compound's structural features may impart specific stereochemical properties, influencing its binding affinity and selectivity for target receptors. Overall, 2-(4-Piperidinyloxy)-4-pyridinecarboxylic acid represents a class of compounds that could be of interest in medicinal chemistry and therapeutic applications.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c14-11(15)8-1-6-13-10(7-8)16-9-2-4-12-5-3-9/h1,6-7,9,12H,2-5H2,(H,14,15)
InChI key:InChIKey=GQIROGXKABDVPK-UHFFFAOYSA-N
SMILES:O(C1=CC(C(O)=O)=CC=N1)C2CCNCC2
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-(4-piperidinyloxy)-
  • 2-(4-Piperidinyloxy)-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.