CAS 1086380-04-2

5-(1H-Imidazol-5-yl)-2-thiophenecarboxylic acid

Description:

5-(1H-Imidazol-5-yl)-2-thiophenecarboxylic acid is an organic compound characterized by the presence of both an imidazole and a thiophene ring, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, making it acidic and capable of participating in various chemical reactions, such as esterification and amidation. The imidazole ring is known for its basicity and ability to coordinate with metal ions, while the thiophene ring adds aromatic stability and potential for electronic interactions. The presence of these heterocycles suggests that the compound may exhibit interesting biological activities, potentially serving as a scaffold for drug development. Additionally, its solubility and reactivity can be influenced by the substituents on the rings, which may affect its applications in pharmaceuticals, agrochemicals, or materials science. Overall, this compound's structural features position it as a versatile molecule in organic synthesis and medicinal chemistry.

Formula: C₈H₆N₂O₂S

InChI: InChI=1S/C8H6N2O2S/c11-8(12)7-2-1-6(13-7)5-3-9-4-10-5/h1-4H,(H,9,10)(H,11,12)

InChI key: InChIKey=HBDIVTWZROMIHR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(=CC1)C2=CN=CN2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(1H-imidazol-5-yl)-
• 5-(1H-Imidazol-5-yl)-2-thiophenecarboxylic acid