CAS 1086380-26-8

2-Amino-5-(3-pyridinyl)-4-thiazolecarboxylic acid

Description:

2-Amino-5-(3-pyridinyl)-4-thiazolecarboxylic acid is a heterocyclic compound characterized by the presence of both thiazole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The thiazole ring, containing sulfur and nitrogen, imparts distinct reactivity and potential biological activity, while the pyridine moiety enhances its solubility and interaction with biological systems. The presence of these functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its potential applications in pharmaceuticals or as a biochemical probe. Additionally, the compound's structure may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied, but its unique structural features indicate potential utility in medicinal chemistry and related fields.

Formula: C₉H₇N₃O₂S

InChI: InChI=1S/C9H7N3O2S/c10-9-12-6(8(13)14)7(15-9)5-2-1-3-11-4-5/h1-4H,(H2,10,12)(H,13,14)

InChI key: InChIKey=LSHMEKRTDXQFFO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(SC(N)=N1)C=2C=CC=NC2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-amino-5-(3-pyridinyl)-
• 2-Amino-5-(3-pyridinyl)-4-thiazolecarboxylic acid