CAS 1086380-29-1: 2-Amino-5-(2-furanyl)-4-thiazolecarboxylic acid

Description: 2-Amino-5-(2-furanyl)-4-thiazolecarboxylic acid is a heterocyclic compound featuring both amino and carboxylic acid functional groups, which contribute to its potential as a biologically active molecule. The presence of a thiazole ring, characterized by a five-membered ring containing sulfur and nitrogen, imparts unique chemical properties, including the ability to participate in various chemical reactions and interactions. The furanyl group, derived from furan, adds aromatic character and can influence the compound's solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of both polar and non-polar functional groups may affect its behavior in biological systems, including absorption, distribution, metabolism, and excretion (ADME) properties. Overall, 2-Amino-5-(2-furanyl)-4-thiazolecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₆N₂O₃S

InChI: InChI=1S/C8H6N2O3S/c9-8-10-5(7(11)12)6(14-8)4-2-1-3-13-4/h1-3H,(H2,9,10)(H,11,12)

InChI key: InChIKey=BSWWQPIVZSLPSL-UHFFFAOYSA-N

SMILES: O=C(O)C=1N=C(SC1C=2OC=CC2)N

Synonyms:

• 2-Amino-5-(2-furanyl)-4-thiazolecarboxylic acid
• 4-Thiazolecarboxylic acid, 2-amino-5-(2-furanyl)-

2-Amino-5-(furan-2-yl)thiazole-4-carboxylic acid

CAS: 1086380-29-1

• Purity: 95+%
• Molecular weight: 210.2100067138672

2-Amino-5-(2-furyl)-1,3-thiazole-4-carboxylic acid

CAS: 1086380-29-1

Versatile small molecule scaffold

• Formula: C₈H₆N₂O₃S
• Purity: Min. 95%
• Molecular weight: 210.21 g/mol