CAS 1086380-60-0

5-Oxo-1-(2-pyrazinyl)-3-pyrrolidinecarboxylic acid

Description:

5-Oxo-1-(2-pyrazinyl)-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a pyrazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents. The presence of the carboxylic acid functional group suggests it may exhibit acidic behavior, allowing for interactions with bases and other functional groups. Additionally, the oxo group contributes to its reactivity, potentially participating in various chemical reactions, including nucleophilic attacks. The pyrazinyl substituent may influence the compound's electronic properties and steric effects, which can be crucial for its biological activity. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural complexity and potential pharmacological properties. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.

Formula: C₉H₉N₃O₃

InChI: InChI=1S/C9H9N3O3/c13-8-3-6(9(14)15)5-12(8)7-4-10-1-2-11-7/h1-2,4,6H,3,5H2,(H,14,15)

InChI key: InChIKey=OIUFODDGIUYXJM-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(O)=O)C1)C=2C=NC=CN2

Synonyms:

• 5-Oxo-1-(2-pyrazinyl)-3-pyrrolidinecarboxylic acid
• 3-Pyrrolidinecarboxylic acid, 5-oxo-1-(2-pyrazinyl)-