CAS 1086381-55-6

2-Bromo-4-cyclobutylpyridine

Description:

2-Bromo-4-cyclobutylpyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the second position and a cyclobutyl group at the fourth position of the pyridine ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the non-polar cyclobutyl group and the polar nature of the pyridine ring. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, the bromine substituent can serve as a leaving group in reactions, enhancing its utility in the synthesis of more complex molecules. The compound's specific applications may vary, but it could be relevant in medicinal chemistry or materials science, depending on its biological activity and physical properties. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₀BrN

InChI: InChI=1S/C9H10BrN/c10-9-6-8(4-5-11-9)7-2-1-3-7/h4-7H,1-3H2

InChI key: InChIKey=JXHDGDJENXFWJV-UHFFFAOYSA-N

SMILES: BrC1=CC(=CC=N1)C2CCC2

Synonyms:

• Pyridine, 2-bromo-4-cyclobutyl-
• 2-Bromo-4-cyclobutylpyridine