
CAS 1086381-61-4
:2-Bromo-6-(3-furanyl)pyridine
Description:
2-Bromo-6-(3-furanyl)pyridine is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with a bromine atom and a furanyl group. The presence of the bromine atom at the 2-position and the furanyl group at the 6-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is typically a pale yellow to brown solid and is soluble in organic solvents such as dichloromethane and ethanol. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the furanyl moiety may enhance its interaction with biological targets. The compound's reactivity can be influenced by the electron-withdrawing nature of the bromine atom and the electron-rich characteristics of the furanyl group, making it a subject of interest for further research in synthetic organic chemistry and drug development. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-9-3-1-2-8(11-9)7-4-5-12-6-7/h1-6H
InChI key:InChIKey=REHXKFHOXHMPLZ-UHFFFAOYSA-N
SMILES:BrC1=NC(=CC=C1)C=2C=COC2
Synonyms:- Pyridine, 2-bromo-6-(3-furanyl)-
- 2-Bromo-6-(3-furanyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.