CAS 1086381-79-4

Pyrimidine, 4-bromo-2-ethyl-

Description:

Pyrimidine, 4-bromo-2-ethyl- is a heterocyclic organic compound characterized by a pyrimidine ring, which consists of a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and an ethyl group at the 2-position contributes to its unique chemical properties. This compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents and has limited solubility in water due to the hydrophobic nature of the ethyl group. Pyrimidine derivatives are of significant interest in medicinal chemistry, as they often exhibit biological activity and can serve as building blocks for pharmaceuticals. The bromine substituent can enhance reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-bromo-2-ethylpyrimidine is a valuable compound in synthetic organic chemistry and drug development.

Formula: C₆H₇BrN₂

InChI: InChI=1S/C6H7BrN2/c1-2-6-8-4-3-5(7)9-6/h3-4H,2H2,1H3

InChI key: InChIKey=SNEAVUIQNCYGRC-UHFFFAOYSA-N

SMILES: C(C)C=1N=C(Br)C=CN1

Synonyms:

• Pyrimidine, 4-bromo-2-ethyl-