CAS 1086382-11-7
:4-Bromo-6-propylpyrimidine
Description:
4-Bromo-6-propylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the 4-position and a propyl group at the 6-position. This compound belongs to the class of pyrimidines, which are six-membered aromatic rings containing two nitrogen atoms at the 1 and 3 positions. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The propyl group contributes to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. 4-Bromo-6-propylpyrimidine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential applications in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-2-3-6-4-7(8)10-5-9-6/h4-5H,2-3H2,1H3
InChI key:InChIKey=SMIHSBFFEJMPKX-UHFFFAOYSA-N
SMILES:C(CC)C=1C=C(Br)N=CN1
Synonyms:- Pyrimidine, 4-bromo-6-propyl-
- 4-Bromo-6-propylpyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.