
CAS 1086382-80-0
:2-Bromo-5-cyclobutylpyrazine
Description:
2-Bromo-5-cyclobutylpyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a bromine atom at the second position and a cyclobutyl group at the fifth position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the cyclobutyl group may influence the compound's steric and electronic properties, affecting its interactions with biological targets. As with many halogenated compounds, safety precautions should be taken when handling 2-Bromo-5-cyclobutylpyrazine due to potential toxicity and environmental impact.
Formula:C8H9BrN2
InChI:InChI=1S/C8H9BrN2/c9-8-5-10-7(4-11-8)6-2-1-3-6/h4-6H,1-3H2
InChI key:InChIKey=VNWBOWOJKOWMJC-UHFFFAOYSA-N
SMILES:BrC=1N=CC(C2CCC2)=NC1
Synonyms:- Pyrazine, 2-bromo-5-cyclobutyl-
- 2-Bromo-5-cyclobutylpyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.