CAS 1086382-82-2

2-Bromo-5-cyclopentylpyrazine

Description:

2-Bromo-5-cyclopentylpyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The compound features a bromine substituent at the second position and a cyclopentyl group at the fifth position of the pyrazine ring. This structure contributes to its unique chemical properties, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The cyclopentyl group adds to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. 2-Bromo-5-cyclopentylpyrazine may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis typically involves bromination and cyclization reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, this compound's unique structural features make it a subject of interest in various chemical and pharmaceutical applications.

Formula: C₉H₁₁BrN₂

InChI: InChI=1S/C9H11BrN2/c10-9-6-11-8(5-12-9)7-3-1-2-4-7/h5-7H,1-4H2

InChI key: InChIKey=CUYRUTNIBSAYPX-UHFFFAOYSA-N

SMILES: BrC=1N=CC(=NC1)C2CCCC2

Synonyms:

• Pyrazine, 2-bromo-5-cyclopentyl-
• 2-Bromo-5-cyclopentylpyrazine