CAS 1086382-84-4

2-Bromo-5-cyclohexylpyrazine

Description:

2-Bromo-5-cyclohexylpyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the second position and a cyclohexyl group at the fifth position of the pyrazine ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is relatively insoluble in water but may dissolve in organic solvents. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the cyclohexyl group can influence the compound's steric and electronic properties, potentially affecting its biological activity and interactions. Due to its structural characteristics, 2-Bromo-5-cyclohexylpyrazine may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₀H₁₃BrN₂

InChI: InChI=1S/C10H13BrN2/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h6-8H,1-5H2

InChI key: InChIKey=XZYGBNRTTXLPBN-UHFFFAOYSA-N

SMILES: BrC=1N=CC(=NC1)C2CCCCC2

Synonyms:

• 2-Bromo-5-cyclohexylpyrazine
• Pyrazine, 2-bromo-5-cyclohexyl-