CymitQuimica logo

CAS 1086382-88-8

:

2-Bromo-5-(cyclohexyloxy)pyrazine

Description:
2-Bromo-5-(cyclohexyloxy)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 2-position and a cyclohexyloxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. The bromine substituent can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The cyclohexyloxy group can influence the compound's lipophilicity and steric properties, potentially affecting its biological activity. As with many halogenated compounds, it is essential to handle 2-Bromo-5-(cyclohexyloxy)pyrazine with care due to potential toxicity and environmental concerns. Overall, this compound serves as a valuable intermediate in the synthesis of more complex molecules and may have applications in pharmaceuticals or agrochemicals.
Formula:C10H13BrN2O
InChI:InChI=1S/C10H13BrN2O/c11-9-6-13-10(7-12-9)14-8-4-2-1-3-5-8/h6-8H,1-5H2
InChI key:InChIKey=KMGKYVTXIPBAAT-UHFFFAOYSA-N
SMILES:O(C=1C=NC(Br)=CN1)C2CCCCC2
Synonyms:
  • 2-Bromo-5-(cyclohexyloxy)pyrazine
  • Pyrazine, 2-bromo-5-(cyclohexyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.