CAS 1086382-94-6

2-Bromo-6-(1-methylethyl)pyrazine

Description:

2-Bromo-6-(1-methylethyl)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 2-position and an isopropyl group at the 6-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in the field of organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The bromine substituent can enhance reactivity, making it useful in further chemical transformations. Additionally, the isopropyl group may influence the compound's solubility and volatility. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Bromo-6-(1-methylethyl)pyrazine is a valuable compound in synthetic chemistry, with specific characteristics that make it suitable for various applications.

Formula: C₇H₉BrN₂

InChI: InChI=1S/C7H9BrN2/c1-5(2)6-3-9-4-7(8)10-6/h3-5H,1-2H3

InChI key: InChIKey=ZVRPFWMAFFULEG-UHFFFAOYSA-N

SMILES: C(C)(C)C1=NC(Br)=CN=C1

Synonyms:

• 2-Bromo-6-(1-methylethyl)pyrazine
• Pyrazine, 2-bromo-6-(1-methylethyl)-