CAS 1086386-59-5
:6-Chloro-N-(4-pyridinylmethyl)-4-pyrimidinamine
Description:
6-Chloro-N-(4-pyridinylmethyl)-4-pyrimidinamine is a chemical compound characterized by its specific structural features, including a chloro substituent and a pyridinylmethyl group attached to a pyrimidinamine core. This compound typically exhibits properties associated with heterocyclic amines, including potential solubility in polar solvents due to the presence of nitrogen atoms in its structure. The chloro group may influence its reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions. The presence of the pyridine ring suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Its unique structure may also confer specific pharmacological properties, making it a subject of interest in drug discovery and development. Overall, the compound's characteristics are defined by its molecular structure, functional groups, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H9ClN4
InChI:InChI=1S/C10H9ClN4/c11-9-5-10(15-7-14-9)13-6-8-1-3-12-4-2-8/h1-5,7H,6H2,(H,13,14,15)
InChI key:InChIKey=KHHGCFDOIVUOTF-UHFFFAOYSA-N
SMILES:N(CC=1C=CN=CC1)C=2C=C(Cl)N=CN2
Synonyms:- 4-Pyrimidinamine, 6-chloro-N-(4-pyridinylmethyl)-
- (6-Chloropyrimidin-4-yl)pyridin-4-ylmethylamine
- 6-Chloro-N-(4-pyridinylmethyl)-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.