CAS 1086386-79-9

1,1-Dimethylethyl N-(3-fluoro-5-iodophenyl)carbamate

Description:

1,1-Dimethylethyl N-(3-fluoro-5-iodophenyl)carbamate, identified by its CAS number 1086386-79-9, is a chemical compound characterized by its unique structural features. It contains a carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. The presence of the 3-fluoro-5-iodophenyl moiety indicates that the compound has halogen substituents, which can influence its reactivity and biological activity. The tert-butyl group (1,1-dimethylethyl) contributes to the compound's steric bulk, potentially affecting its solubility and interaction with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, the unique combination of functional groups and substituents in this compound suggests potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₃FINO₂

InChI: InChI=1S/C11H13FINO2/c1-11(2,3)16-10(15)14-9-5-7(12)4-8(13)6-9/h4-6H,1-3H3,(H,14,15)

InChI key: InChIKey=BEDDKXJLMJLOLV-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=CC(F)=CC(I)=C1

Synonyms:

• 1,1-Dimethylethyl N-(3-fluoro-5-iodophenyl)carbamate
• Carbamic acid, N-(3-fluoro-5-iodophenyl)-, 1,1-dimethylethyl ester