CAS 1086391-08-3: 3-Bromo-1H-indazole-5-carboxaldehyde
Description:3-Bromo-1H-indazole-5-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 3-position and an aldehyde functional group at the 5-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in the synthesis of more complex molecules. The bromine substituent can serve as a site for nucleophilic substitution reactions, while the aldehyde group can participate in condensation reactions. Additionally, compounds like 3-Bromo-1H-indazole-5-carboxaldehyde may exhibit biological activity, making them of interest in pharmaceutical research. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-8-6-3-5(4-12)1-2-7(6)10-11-8/h1-4H,(H,10,11)
InChI key:InChIKey=HUUXQTDSLDFUQW-UHFFFAOYSA-N
SMILES:O=CC=1C=CC=2NN=C(Br)C2C1
- Synonyms:
- 1H-Indazole-5-carboxaldehyde, 3-bromo-
- 3-Bromo-1H-indazole-5-carbaldehyde
- 3-Bromo-2H-indazole-5-carbaldehyde
- 3-Bromo-1H-indazole-5-carboxaldehyde

3-Bromo-1H-indazole-5-carboxaldehyde
Ref: IN-DA003IZI
1g | 251.00 € | ||
5g | 549.00 € | ||
10g | To inquire | ||
25g | To inquire | ||
100mg | 75.00 € | ||
250mg | 120.00 € |

3-Bromo-1H-indazole-5-carbaldehyde
Ref: 54-OR321277
1g | 251.00 € | ||
250mg | 90.00 € |

Ref: 10-F952459
1g | 210.00 € | ||
5g | 401.00 € | ||
10g | 656.00 € | ||
25g | 1,268.00 € | ||
250mg | 80.00 € |