
CAS 1086391-25-4
:3-(1-Methylethoxy)-5-isoxazolecarboxylic acid
Description:
3-(1-Methylethoxy)-5-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity in various chemical reactions. The presence of the 1-methylethoxy group enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds like this can exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in this molecule can lead to unique interactions with biological targets, potentially resulting in therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(1-Methylethoxy)-5-isoxazolecarboxylic acid represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C7H9NO4
InChI:InChI=1S/C7H9NO4/c1-4(2)11-6-3-5(7(9)10)12-8-6/h3-4H,1-2H3,(H,9,10)
InChI key:InChIKey=CGTOXERUNSOEKY-UHFFFAOYSA-N
SMILES:O(C(C)C)C=1C=C(C(O)=O)ON1
Synonyms:- 3-(1-Methylethoxy)-5-isoxazolecarboxylic acid
- 3-Isopropoxyisoxazole-5-carboxylic acid
- 5-Isoxazolecarboxylic acid, 3-(1-methylethoxy)-
- 3-Isopropoxy-isoxazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.