CymitQuimica logo

CAS 1086392-07-5

:

1,1-Dimethylethyl N-[2-amino-2-(3-bromophenyl)ethyl]carbamate

Description:
1,1-Dimethylethyl N-[2-amino-2-(3-bromophenyl)ethyl]carbamate, identified by its CAS number 1086392-07-5, is a chemical compound that features a carbamate functional group. This substance is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) attached to a nitrogen atom, which is further linked to an amino group that is substituted with a 3-bromophenyl moiety. The bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity. The amino group contributes to the compound's potential as a ligand in various chemical reactions or biological interactions. The overall structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmaceutical agent or a precursor in synthetic pathways. Its solubility, stability, and specific reactivity would depend on the surrounding conditions, such as pH and solvent polarity. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C13H19BrN2O2
InChI:InChI=1S/C13H19BrN2O2/c1-13(2,3)18-12(17)16-8-11(15)9-5-4-6-10(14)7-9/h4-7,11H,8,15H2,1-3H3,(H,16,17)
InChI key:InChIKey=GYXPOVYGRXGVBV-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(N)C1=CC(Br)=CC=C1
Synonyms:
  • 1,1-Dimethylethyl N-[2-amino-2-(3-bromophenyl)ethyl]carbamate
  • Carbamic acid, N-[2-amino-2-(3-bromophenyl)ethyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.