CymitQuimica logo

CAS 1086392-22-4

:

Methyl 7-(trifluoromethoxy)-1H-indazole-3-carboxylate

Description:
Methyl 7-(trifluoromethoxy)-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a trifluoromethoxy group, which significantly influences its chemical reactivity and polarity due to the presence of three fluorine atoms. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents and may affect its biological activity. The presence of the trifluoromethoxy group can also impart unique electronic properties, making it of interest in medicinal chemistry and material science. Typically, compounds like this are studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, Methyl 7-(trifluoromethoxy)-1H-indazole-3-carboxylate represents a class of compounds that may exhibit interesting biological and chemical properties due to its unique structural features.
Formula:C10H7F3N2O3
InChI:InChI=1S/C10H7F3N2O3/c1-17-9(16)8-5-3-2-4-6(7(5)14-15-8)18-10(11,12)13/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=JUWDBDFQDYSPPI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(=C(OC(F)(F)F)C=CC2)NN1
Synonyms:
  • 1H-Indazole-3-carboxylic acid, 7-(trifluoromethoxy)-, methyl ester
  • Methyl 7-(trifluoromethoxy)-1H-indazole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.