CymitQuimica logo

CAS 1086392-40-6

:

(6-Amino-2,3-dihydro-1H-indol-1-yl)(tetrahydro-2H-pyran-4-yl)methanone

Description:
(6-Amino-2,3-dihydro-1H-indol-1-yl)(tetrahydro-2H-pyran-4-yl)methanone is a chemical compound characterized by its complex structure, which includes an indole moiety and a tetrahydropyran ring. The presence of an amino group at the 6-position of the indole contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of indole derivatives, such as potential pharmacological effects, including antimicrobial or anticancer activities, due to the indole's role in various biological systems. The tetrahydropyran ring adds to the molecular complexity and may influence solubility and lipophilicity, which are important for drug-like properties. The methanone functional group suggests the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c15-12-2-1-10-3-6-16(13(10)9-12)14(17)11-4-7-18-8-5-11/h1-2,9,11H,3-8,15H2
InChI key:InChIKey=AOCNDTUNXUOSCE-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(CC1)=CC=C(N)C2)C3CCOCC3
Synonyms:
  • (6-Amino-2,3-dihydro-1H-indol-1-yl)(tetrahydro-2H-pyran-4-yl)methanone
  • Methanone, (6-amino-2,3-dihydro-1H-indol-1-yl)(tetrahydro-2H-pyran-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.