CymitQuimica logo

CAS 1086392-44-0

:

1,1-Dimethylethyl N-[(2,3-dihydro-5-methoxy-2-oxo-1H-indol-3-yl)methyl]carbamate

Description:
1,1-Dimethylethyl N-[(2,3-dihydro-5-methoxy-2-oxo-1H-indol-3-yl)methyl]carbamate, with the CAS number 1086392-44-0, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and an indole derivative. This compound typically exhibits properties associated with both the carbamate and indole moieties, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group suggests possible interactions with biological systems, potentially influencing its pharmacological properties. The compound may be of interest in medicinal chemistry due to its structural features, which could contribute to its efficacy in various biological applications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-15(2,3)21-14(19)16-8-11-10-7-9(20-4)5-6-12(10)17-13(11)18/h5-7,11H,8H2,1-4H3,(H,16,19)(H,17,18)
InChI key:InChIKey=GUAMVKPPVAZNIE-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1C=2C(NC1=O)=CC=C(OC)C2
Synonyms:
  • 1,1-Dimethylethyl N-[(2,3-dihydro-5-methoxy-2-oxo-1H-indol-3-yl)methyl]carbamate
  • Carbamic acid, N-[(2,3-dihydro-5-methoxy-2-oxo-1H-indol-3-yl)methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.