
CAS 1086392-60-0: N-Hydroxy-1-isoquinolinecarboxamide
Description:N-Hydroxy-1-isoquinolinecarboxamide is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety and a hydroxamic acid functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential reactivity and biological activity. Hydroxamic acids are known for their ability to chelate metal ions, which can influence various biochemical pathways. The presence of the isoquinoline structure may also impart specific pharmacological properties, as isoquinolines are often found in biologically active compounds. N-Hydroxy-1-isoquinolinecarboxamide may be utilized in medicinal chemistry and drug development, particularly in the context of targeting metalloproteins or as a potential therapeutic agent. Its solubility, stability, and interaction with biological systems would depend on the specific conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions should be observed, especially in laboratory settings. Further research may elucidate its full range of applications and mechanisms of action.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c13-10(12-14)9-8-4-2-1-3-7(8)5-6-11-9/h1-6,14H,(H,12,13)
InChI key:InChIKey=RAEHCTXSBJRQAN-UHFFFAOYSA-N
SMILES:O=C(NO)C1=NC=CC=2C=CC=CC21
- Synonyms:
- N-Hydroxy-1-isoquinolinecarboxamide
- 1-Isoquinolinecarboxamide, N-hydroxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Isoquinoline-1-carboxylic acid hydroxyamide REF: 3D-LTB39260CAS: 1086392-60-0 | Min. 95% | - - - | Discontinued product |

Isoquinoline-1-carboxylic acid hydroxyamide
Ref: 3D-LTB39260
5g | Discontinued | Request information |