CAS 1086392-66-6
:Decahydro-2-(phenylmethyl)-2,6-naphthyridine
Description:
Decahydro-2-(phenylmethyl)-2,6-naphthyridine is a bicyclic organic compound characterized by its complex structure, which includes a naphthyridine core fused with a saturated decahydro framework. This compound features a phenylmethyl substituent, contributing to its unique chemical properties. Typically, naphthyridines exhibit basicity due to the presence of nitrogen atoms in the ring structure, which can participate in protonation reactions. The presence of the phenylmethyl group may enhance lipophilicity, influencing its solubility and interaction with biological systems. Decahydro-2-(phenylmethyl)-2,6-naphthyridine may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its potential applications could range from acting as a ligand in coordination chemistry to serving as a scaffold for drug development. However, specific reactivity, stability, and biological activity would depend on the precise conditions and environment in which the compound is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H22N2
InChI:InChI=1S/C15H22N2/c1-2-4-13(5-3-1)11-17-9-7-14-10-16-8-6-15(14)12-17/h1-5,14-16H,6-12H2
InChI key:InChIKey=HMEQPPDSBRYYKW-UHFFFAOYSA-N
SMILES:C(N1CC2C(CC1)CNCC2)C3=CC=CC=C3
Synonyms:- Decahydro-2-(phenylmethyl)-2,6-naphthyridine
- 2,6-Naphthyridine, decahydro-2-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
