CAS 1086392-68-8
:4-[4-(Methylsulfonyl)phenyl]-4-piperidinol
Description:
4-[4-(Methylsulfonyl)phenyl]-4-piperidinol, identified by its CAS number 1086392-68-8, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methylsulfonyl group attached to a phenyl ring, contributing to its unique properties. The presence of the piperidinol moiety suggests that it may exhibit both basic and alcohol functionalities, potentially allowing for hydrogen bonding interactions. The methylsulfonyl group enhances its solubility in polar solvents and may influence its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the piperidine structure can lead to variations in pharmacological properties. Its stability, reactivity, and interactions with biological targets would depend on the specific functional groups and their spatial arrangement. Overall, 4-[4-(Methylsulfonyl)phenyl]-4-piperidinol represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C12H17NO3S
InChI:InChI=1S/C12H17NO3S/c1-17(15,16)11-4-2-10(3-5-11)12(14)6-8-13-9-7-12/h2-5,13-14H,6-9H2,1H3
InChI key:InChIKey=HQLHLHBFYKVFRC-UHFFFAOYSA-N
SMILES:OC1(CCNCC1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:- 4-[4-(Methylsulfonyl)phenyl]-4-piperidinol
- 4-Piperidinol, 4-[4-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
