CAS 1086392-88-2
:2-[[1-[(1,1-Dimethylethoxy)carbonyl]-3-pyrrolidinyl]oxy]-3-pyridinecarboxylic acid
Description:
2-[[1-[(1,1-Dimethylethoxy)carbonyl]-3-pyrrolidinyl]oxy]-3-pyridinecarboxylic acid, identified by its CAS number 1086392-88-2, is a chemical compound characterized by its complex structure that includes a pyridine ring and a pyrrolidine moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective or modifying characteristics, often utilized in synthetic organic chemistry to enhance stability or solubility. The compound's molecular structure suggests it may exhibit specific biological activities, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, which are critical for its application in synthesis or as a potential drug candidate. Overall, this compound exemplifies the intricate interplay of functional groups that can influence its chemical behavior and potential uses in various fields, including medicinal chemistry and materials science.
Formula:C15H20N2O5
InChI:InChI=1S/C15H20N2O5/c1-15(2,3)22-14(20)17-8-6-10(9-17)21-12-11(13(18)19)5-4-7-16-12/h4-5,7,10H,6,8-9H2,1-3H3,(H,18,19)
InChI key:InChIKey=ZVZNJJHZMXHXCB-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=CC=N1)C2CN(C(OC(C)(C)C)=O)CC2
Synonyms:- 2-[[1-[(1,1-Dimethylethoxy)carbonyl]-3-pyrrolidinyl]oxy]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[[1-[(1,1-dimethylethoxy)carbonyl]-3-pyrrolidinyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-((1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)oxy)nicotinic acid
CAS:Formula:C15H20N2O5Molecular weight:308.3297
