
CAS 1086393-02-3
:5-Nitro-2-pyrimidinecarboxylic acid
Description:
5-Nitro-2-pyrimidinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The compound features a nitro group (-NO2) at the 5-position and a carboxylic acid group (-COOH) at the 2-position of the pyrimidine ring, contributing to its acidic properties. This structure imparts unique chemical reactivity, making it useful in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. The presence of both the nitro and carboxylic acid functional groups enhances its potential for hydrogen bonding and reactivity in electrophilic substitution reactions. Additionally, the compound may exhibit polar characteristics due to the electronegative nitrogen and oxygen atoms, influencing its solubility in polar solvents. Overall, 5-Nitro-2-pyrimidinecarboxylic acid is a valuable compound in organic synthesis and medicinal chemistry, with potential applications in drug development and research.
Formula:C5H3N3O4
InChI:InChI=1S/C5H3N3O4/c9-5(10)4-6-1-3(2-7-4)8(11)12/h1-2H,(H,9,10)
InChI key:InChIKey=DFFNNSKQSUCTCZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=NC(C(O)=O)=NC1
Synonyms:- 5-Nitro-2-pyrimidinecarboxylic acid
- 2-Pyrimidinecarboxylic acid, 5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
