CymitQuimica logo

CAS 1086393-06-7

:

Methyl 5-phenyl-3-pyrrolidinecarboxylate

Description:
Methyl 5-phenyl-3-pyrrolidinecarboxylate is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a phenyl group attached to the 5-position of the pyrrolidine ring and a carboxylate ester functional group at the 3-position, specifically as a methyl ester. The presence of the phenyl group contributes to its aromatic characteristics, while the pyrrolidine ring imparts cyclic and basic properties. Methyl 5-phenyl-3-pyrrolidinecarboxylate is likely to exhibit moderate polarity due to the ester and amine functionalities, influencing its solubility in various organic solvents. Additionally, the compound may participate in typical reactions associated with esters, such as hydrolysis and transesterification. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrolidine derivatives. However, specific biological activity and safety data would require further investigation and analysis.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c1-15-12(14)10-7-11(13-8-10)9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3
InChI key:InChIKey=FANZXFOPODODBE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(NC1)C2=CC=CC=C2
Synonyms:
  • Methyl 5-phenyl-3-pyrrolidinecarboxylate
  • 3-Pyrrolidinecarboxylic acid, 5-phenyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.